C17H22ClN3O — CID 143940059
2-[(2Z)-2-(6-amino-4-chlorocyclohexa-2,4-dien-1-ylidene)hydrazinyl]-6-tert-butyl-4-methylphenol (PubChem CID 143940059) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 2-[(2Z)-2-(6-amino-4-chlorocyclohexa-2,4-dien-1-ylidene)hydrazinyl]-6-tert-butyl-4-methylphenol.
| Compound Name | 2-[(2Z)-2-(6-amino-4-chlorocyclohexa-2,4-dien-1-ylidene)hydrazinyl]-6-tert-butyl-4-methylphenol |
|---|---|
| PubChem CID | 143940059 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[(2Z)-2-(6-amino-4-chlorocyclohexa-2,4-dien-1-ylidene)hydrazinyl]-6-tert-butyl-4-methylphenol |
| SMILES | Cc1cc(N/N=C2/C=CC(Cl)=CC2N)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H22ClN3O/c1-10-7-12(17(2,3)4)16(22)15(8-10)21-20-14-6-5-11(18)9-13(14)19/h5-9,13,21-22H,19H2,1-4H3/b20-14- |
| InChIKey | XHERTBAVQIGHGV-ZHZULCJRSA-N |
| XLogP | 3.79 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|