C28H42O3S — CID 10790081
2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)sulfinylphenol (PubChem CID 10790081) has the molecular formula C28H42O3S and a molecular weight of 458.71 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)sulfinylphenol.
| Compound Name | 2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)sulfinylphenol |
|---|---|
| PubChem CID | 10790081 |
| Molecular Formula | C28H42O3S |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 2,4-ditert-butyl-6-(3,5-ditert-butyl-2-hydroxyphenyl)sulfinylphenol |
| SMILES | CC(C)(C)c1cc(S(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H42O3S/c1-25(2,3)17-13-19(27(7,8)9)23(29)21(15-17)32(31)22-16-18(26(4,5)6)14-20(24(22)30)28(10,11)12/h13-16,29-30H,1-12H3 |
| InChIKey | UDIQUNQMNWAZJX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |