C22H30O2S — CID 10522420
2,4-ditert-butyl-6-[(4-methylsulfinylphenyl)methyl]phenol (PubChem CID 10522420) has the molecular formula C22H30O2S and a molecular weight of 358.55 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(4-methylsulfinylphenyl)methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[(4-methylsulfinylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 10522420 |
| Molecular Formula | C22H30O2S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2,4-ditert-butyl-6-[(4-methylsulfinylphenyl)methyl]phenol |
| SMILES | CS(=O)c1ccc(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)cc1 |
| InChI | InChI=1S/C22H30O2S/c1-21(2,3)17-13-16(20(23)19(14-17)22(4,5)6)12-15-8-10-18(11-9-15)25(7)24/h8-11,13-14,23H,12H2,1-7H3 |
| InChIKey | OSFGQIMKXCHVOS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |