C56H81NO3 — CID 139127127
acetonitrile;2-[[3,5-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-4,6-ditert-butylphenol (PubChem CID 139127127) has the molecular formula C56H81NO3 and a molecular weight of 816.27 g/mol. Its IUPAC name is acetonitrile;2-[[3,5-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-4,6-ditert-butylphenol.
| Compound Name | acetonitrile;2-[[3,5-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 139127127 |
| Molecular Formula | C56H81NO3 |
| Molecular Weight | 816.27 g/mol |
| Exact Mass | 815.62 |
| IUPAC Name | acetonitrile;2-[[3,5-bis[(3,5-ditert-butyl-2-hydroxyphenyl)methyl]-2,4,6-trimethylphenyl]methyl]-4,6-ditert-butylphenol |
| SMILES | CC#N.Cc1c(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(C)c(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(C)c1Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C54H78O3.C2H3N/c1-31-40(25-34-22-37(49(4,5)6)28-43(46(34)55)52(13,14)15)32(2)42(27-36-24-39(51(10,11)12)30-45(48(36)57)54(19,20)21)33(3)41(31)26-35-23-38(50(7,8)9)29-44(47(35)56)53(16,17)18;1-2-3/h22-24,28-30,55-57H,25-27H2,1-21H3;1H3 |
| InChIKey | BWVABMCOZLVFNO-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.27 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |