C26H40N2O+2 — CID 7445355
2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-4,6-ditert-butylphenol (PubChem CID 7445355) has the molecular formula C26H40N2O+2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 7445355 |
| Molecular Formula | C26H40N2O+2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | 2-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(C[NH+]2CC[NH+](Cc3ccccc3)CC2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H38N2O/c1-25(2,3)22-16-21(24(29)23(17-22)26(4,5)6)19-28-14-12-27(13-15-28)18-20-10-8-7-9-11-20/h7-11,16-17,29H,12-15,18-19H2,1-6H3/p+2 |
| InChIKey | OROPZOODADQDSL-UHFFFAOYSA-P |
| XLogP | 2.47 |
| TPSA | 29.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|