C21H25ClO2 — CID 164678977
(6E)-4-chloro-6-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 164678977) has the molecular formula C21H25ClO2 and a molecular weight of 344.88 g/mol. Its IUPAC name is (6E)-4-chloro-6-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | (6E)-4-chloro-6-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 164678977 |
| Molecular Formula | C21H25ClO2 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (6E)-4-chloro-6-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)c1cc(/C=C2\C=C(Cl)C=CC2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H25ClO2/c1-20(2,3)16-10-13(11-17(19(16)24)21(4,5)6)9-14-12-15(22)7-8-18(14)23/h7-12,24H,1-6H3/b14-9+ |
| InChIKey | RGEBJRSEIQQIRD-NTEUORMPSA-N |
| XLogP | 5.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|