C20H28N2O3 — CID 54460719
3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-oxopyrrolidine-1-carboxamide (PubChem CID 54460719) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-oxopyrrolidine-1-carboxamide.
| Compound Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-oxopyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 54460719 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-oxopyrrolidine-1-carboxamide |
| SMILES | CC(C)(C)c1cc(C=C2CCN(C(N)=O)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H28N2O3/c1-19(2,3)14-10-12(11-15(16(14)23)20(4,5)6)9-13-7-8-22(17(13)24)18(21)25/h9-11,23H,7-8H2,1-6H3,(H2,21,25) |
| InChIKey | XBKGPGCIUGDNJU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|