C21H31NO2S — CID 19610341
(2E)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-ethylthiomorpholin-3-one (PubChem CID 19610341) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is (2E)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-ethylthiomorpholin-3-one.
| Compound Name | (2E)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-ethylthiomorpholin-3-one |
|---|---|
| PubChem CID | 19610341 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | (2E)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-ethylthiomorpholin-3-one |
| SMILES | CCN1CCS/C(=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C1=O |
| InChI | InChI=1S/C21H31NO2S/c1-8-22-9-10-25-17(19(22)24)13-14-11-15(20(2,3)4)18(23)16(12-14)21(5,6)7/h11-13,23H,8-10H2,1-7H3/b17-13+ |
| InChIKey | MLVVYMGCBIKHNF-GHRIWEEISA-N |
| XLogP | 4.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|