C20H27N5O2S — CID 54012810
5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(2H-tetrazol-5-ylmethyl)-1,3-thiazolidin-4-one (PubChem CID 54012810) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(2H-tetrazol-5-ylmethyl)-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(2H-tetrazol-5-ylmethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 54012810 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(2H-tetrazol-5-ylmethyl)-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1cc(C=C2SCN(Cc3nn[nH]n3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H27N5O2S/c1-19(2,3)13-7-12(8-14(17(13)26)20(4,5)6)9-15-18(27)25(11-28-15)10-16-21-23-24-22-16/h7-9,26H,10-11H2,1-6H3,(H,21,22,23,24) |
| InChIKey | KTODRBSPZCVDSM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|