C22H29N5O2S — CID 57168053
2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[2-(2H-tetrazol-5-yl)ethyl]-1,4-thiazin-3-one (PubChem CID 57168053) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[2-(2H-tetrazol-5-yl)ethyl]-1,4-thiazin-3-one.
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[2-(2H-tetrazol-5-yl)ethyl]-1,4-thiazin-3-one |
|---|---|
| PubChem CID | 57168053 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[2-(2H-tetrazol-5-yl)ethyl]-1,4-thiazin-3-one |
| SMILES | CC(C)(C)c1cc(C=C2SC=CN(CCc3nn[nH]n3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H29N5O2S/c1-21(2,3)15-11-14(12-16(19(15)28)22(4,5)6)13-17-20(29)27(9-10-30-17)8-7-18-23-25-26-24-18/h9-13,28H,7-8H2,1-6H3,(H,23,24,25,26) |
| InChIKey | XPHBRJXOOKAAJA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|