C27H33N5O2S — CID 57169058
2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[3-(2H-tetrazol-5-yl)propyl]-1,4-benzothiazin-3-one (PubChem CID 57169058) has the molecular formula C27H33N5O2S and a molecular weight of 491.66 g/mol. Its IUPAC name is 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[3-(2H-tetrazol-5-yl)propyl]-1,4-benzothiazin-3-one.
| Compound Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[3-(2H-tetrazol-5-yl)propyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 57169058 |
| Molecular Formula | C27H33N5O2S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[3-(2H-tetrazol-5-yl)propyl]-1,4-benzothiazin-3-one |
| SMILES | CC(C)(C)c1cc(C=C2Sc3ccccc3N(CCCc3nn[nH]n3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H33N5O2S/c1-26(2,3)18-14-17(15-19(24(18)33)27(4,5)6)16-22-25(34)32(13-9-12-23-28-30-31-29-23)20-10-7-8-11-21(20)35-22/h7-8,10-11,14-16,33H,9,12-13H2,1-6H3,(H,28,29,30,31) |
| InChIKey | WLSXZODRYKOCIK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|