C27H33NO3S — CID 126153325
(5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126153325) has the molecular formula C27H33NO3S and a molecular weight of 451.63 g/mol. Its IUPAC name is (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126153325 |
| Molecular Formula | C27H33NO3S |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (5E)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)(C)c1cc(/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H33NO3S/c1-26(2,3)20-15-19(16-21(23(20)29)27(4,5)6)17-22-24(30)28(25(31)32-22)14-10-13-18-11-8-7-9-12-18/h7-9,11-12,15-17,29H,10,13-14H2,1-6H3/b22-17+ |
| InChIKey | UWZXEINGVVGYBC-OQKWZONESA-N |
| XLogP | 6.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|