C25H28N2O2S — CID 54061185
2-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetonitrile (PubChem CID 54061185) has the molecular formula C25H28N2O2S and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetonitrile.
| Compound Name | 2-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 54061185 |
| Molecular Formula | C25H28N2O2S |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetonitrile |
| SMILES | CC(C)(C)c1cc(C=C2Sc3ccccc3N(CC#N)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H28N2O2S/c1-24(2,3)17-13-16(14-18(22(17)28)25(4,5)6)15-21-23(29)27(12-11-26)19-9-7-8-10-20(19)30-21/h7-10,13-15,28H,12H2,1-6H3 |
| InChIKey | LZUUCHHGCPYINT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|