C24H28N2O2S2 — CID 2910888
5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2910888) has the molecular formula C24H28N2O2S2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2910888 |
| Molecular Formula | C24H28N2O2S2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1cc(C=C2SC(=S)N(Cc3cccnc3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H28N2O2S2/c1-23(2,3)17-10-16(11-18(20(17)27)24(4,5)6)12-19-21(28)26(22(29)30-19)14-15-8-7-9-25-13-15/h7-13,27H,14H2,1-6H3 |
| InChIKey | IVQFYEWGGHZFBU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|