C19H13ClN2O2S2 — CID 2269248
(5E)-5-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2269248) has the molecular formula C19H13ClN2O2S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2269248 |
| Molecular Formula | C19H13ClN2O2S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | (5E)-5-[(3-chloro-4-prop-2-ynoxyphenyl)methylidene]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1ccc(/C=C2/SC(=S)N(Cc3cccnc3)C2=O)cc1Cl |
| InChI | InChI=1S/C19H13ClN2O2S2/c1-2-8-24-16-6-5-13(9-15(16)20)10-17-18(23)22(19(25)26-17)12-14-4-3-7-21-11-14/h1,3-7,9-11H,8,12H2/b17-10+ |
| InChIKey | AHOOHOVKNSNYAH-LICLKQGHSA-N |
| XLogP | 4.15 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|