C28H33NO5S — CID 70270380
methyl 2-[(2Z)-2-[(4-acetyloxy-3,5-ditert-butylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetate (PubChem CID 70270380) has the molecular formula C28H33NO5S and a molecular weight of 495.64 g/mol. Its IUPAC name is methyl 2-[(2Z)-2-[(4-acetyloxy-3,5-ditert-butylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetate.
| Compound Name | methyl 2-[(2Z)-2-[(4-acetyloxy-3,5-ditert-butylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetate |
|---|---|
| PubChem CID | 70270380 |
| Molecular Formula | C28H33NO5S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | methyl 2-[(2Z)-2-[(4-acetyloxy-3,5-ditert-butylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetate |
| SMILES | COC(=O)CN1C(=O)/C(=C/c2cc(C(C)(C)C)c(OC(C)=O)c(C(C)(C)C)c2)Sc2ccccc21 |
| InChI | InChI=1S/C28H33NO5S/c1-17(30)34-25-19(27(2,3)4)13-18(14-20(25)28(5,6)7)15-23-26(32)29(16-24(31)33-8)21-11-9-10-12-22(21)35-23/h9-15H,16H2,1-8H3/b23-15- |
| InChIKey | QCNGQAMQZHFVKH-HAHDFKILSA-N |
| XLogP | 5.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|