C20H22NO5PS — CID 54528640
[2-[(3-tert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]methylphosphonic acid (PubChem CID 54528640) has the molecular formula C20H22NO5PS and a molecular weight of 419.44 g/mol. Its IUPAC name is [2-[(3-tert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]methylphosphonic acid.
| Compound Name | [2-[(3-tert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 54528640 |
| Molecular Formula | C20H22NO5PS |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [2-[(3-tert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]methylphosphonic acid |
| SMILES | CC(C)(C)c1cc(C=C2Sc3ccccc3N(CP(=O)(O)O)C2=O)ccc1O |
| InChI | InChI=1S/C20H22NO5PS/c1-20(2,3)14-10-13(8-9-16(14)22)11-18-19(23)21(12-27(24,25)26)15-6-4-5-7-17(15)28-18/h4-11,22H,12H2,1-3H3,(H2,24,25,26) |
| InChIKey | YUXVFVNPKMNMKX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|