C27H33NO4S — CID 57312380
4-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]butanoic acid (PubChem CID 57312380) has the molecular formula C27H33NO4S and a molecular weight of 467.63 g/mol. Its IUPAC name is 4-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]butanoic acid.
| Compound Name | 4-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 57312380 |
| Molecular Formula | C27H33NO4S |
| Molecular Weight | 467.63 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 4-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]butanoic acid |
| SMILES | CC(C)(C)c1cc(C=C2Sc3ccccc3N(CCCC(=O)O)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H33NO4S/c1-26(2,3)18-14-17(15-19(24(18)31)27(4,5)6)16-22-25(32)28(13-9-12-23(29)30)20-10-7-8-11-21(20)33-22/h7-8,10-11,14-16,31H,9,12-13H2,1-6H3,(H,29,30) |
| InChIKey | LOTFBIQHOWLQLP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|