C19H17N5O2S — CID 54261890
2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-4-(2H-tetrazol-5-ylmethyl)-1,4-benzothiazin-3-one (PubChem CID 54261890) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-4-(2H-tetrazol-5-ylmethyl)-1,4-benzothiazin-3-one.
| Compound Name | 2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-4-(2H-tetrazol-5-ylmethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 54261890 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-4-(2H-tetrazol-5-ylmethyl)-1,4-benzothiazin-3-one |
| SMILES | Cc1cc(C=C2Sc3ccccc3N(Cc3nn[nH]n3)C2=O)cc(C)c1O |
| InChI | InChI=1S/C19H17N5O2S/c1-11-7-13(8-12(2)18(11)25)9-16-19(26)24(10-17-20-22-23-21-17)14-5-3-4-6-15(14)27-16/h3-9,25H,10H2,1-2H3,(H,20,21,22,23) |
| InChIKey | RECHHVMVRKXCQX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|