C26H37N5O2S — CID 19423077
(2Z)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[6-(2H-tetrazol-5-yl)hexyl]-1,4-thiazin-3-one (PubChem CID 19423077) has the molecular formula C26H37N5O2S and a molecular weight of 483.68 g/mol. Its IUPAC name is (2Z)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[6-(2H-tetrazol-5-yl)hexyl]-1,4-thiazin-3-one.
| Compound Name | (2Z)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[6-(2H-tetrazol-5-yl)hexyl]-1,4-thiazin-3-one |
|---|---|
| PubChem CID | 19423077 |
| Molecular Formula | C26H37N5O2S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (2Z)-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-[6-(2H-tetrazol-5-yl)hexyl]-1,4-thiazin-3-one |
| SMILES | CC(C)(C)c1cc(/C=C2\SC=CN(CCCCCCc3nn[nH]n3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H37N5O2S/c1-25(2,3)19-15-18(16-20(23(19)32)26(4,5)6)17-21-24(33)31(13-14-34-21)12-10-8-7-9-11-22-27-29-30-28-22/h13-17,32H,7-12H2,1-6H3,(H,27,28,29,30)/b21-17- |
| InChIKey | ZJOMACGQOTWLRI-FXBPSFAMSA-N |
| XLogP | 5.69 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|