C21H27NO2S2 — CID 18936379
(5Z)-3-cyclopropyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 18936379) has the molecular formula C21H27NO2S2 and a molecular weight of 389.59 g/mol. Its IUPAC name is (5Z)-3-cyclopropyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-cyclopropyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18936379 |
| Molecular Formula | C21H27NO2S2 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (5Z)-3-cyclopropyl-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1cc(/C=C2\SC(=S)N(C3CC3)C2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H27NO2S2/c1-20(2,3)14-9-12(10-15(17(14)23)21(4,5)6)11-16-18(24)22(13-7-8-13)19(25)26-16/h9-11,13,23H,7-8H2,1-6H3/b16-11- |
| InChIKey | MNDUXOJILXOZHC-WJDWOHSUSA-N |
| XLogP | 5.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|