C20H29ClN2O3S — CID 139823674
(2Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-(methoxymethylimino)-1,3-thiazolidin-4-one;hydrochloride (PubChem CID 139823674) has the molecular formula C20H29ClN2O3S and a molecular weight of 412.98 g/mol. Its IUPAC name is (2Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-(methoxymethylimino)-1,3-thiazolidin-4-one;hydrochloride.
| Compound Name | (2Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-(methoxymethylimino)-1,3-thiazolidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 139823674 |
| Molecular Formula | C20H29ClN2O3S |
| Molecular Weight | 412.98 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-2-(methoxymethylimino)-1,3-thiazolidin-4-one;hydrochloride |
| SMILES | COC/N=C1/NC(=O)C(=Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)S1.Cl |
| InChI | InChI=1S/C20H28N2O3S.ClH/c1-19(2,3)13-8-12(9-14(16(13)23)20(4,5)6)10-15-17(24)22-18(26-15)21-11-25-7;/h8-10,23H,11H2,1-7H3,(H,21,22,24);1H |
| InChIKey | QAGMRXLGIXVTDG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|