C19H26N2O4S2 — CID 135406466
(NZ)-N-[(5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]methanesulfonamide (PubChem CID 135406466) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is (NZ)-N-[(5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]methanesulfonamide.
| Compound Name | (NZ)-N-[(5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]methanesulfonamide |
|---|---|
| PubChem CID | 135406466 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (NZ)-N-[(5Z)-5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]methanesulfonamide |
| SMILES | CC(C)(C)c1cc(/C=C2\S/C(=N\S(C)(=O)=O)NC2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C19H26N2O4S2/c1-18(2,3)12-8-11(9-13(15(12)22)19(4,5)6)10-14-16(23)20-17(26-14)21-27(7,24)25/h8-10,22H,1-7H3,(H,20,21,23)/b14-10- |
| InChIKey | NMLWRYYOKSGPAH-UVTDQMKNSA-N |
| XLogP | 3.51 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|