C21H31NO2 — CID 88520129
(3Z)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-ethylpyrrolidin-2-one (PubChem CID 88520129) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is (3Z)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-ethylpyrrolidin-2-one.
| Compound Name | (3Z)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-ethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 88520129 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | (3Z)-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-ethylpyrrolidin-2-one |
| SMILES | CCN1CC/C(=C/c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C1=O |
| InChI | InChI=1S/C21H31NO2/c1-8-22-10-9-15(19(22)24)11-14-12-16(20(2,3)4)18(23)17(13-14)21(5,6)7/h11-13,23H,8-10H2,1-7H3/b15-11- |
| InChIKey | SNJAJGBRRRRMGT-PTNGSMBKSA-N |
| XLogP | 4.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|