C27H35ClN2O2 — CID 161257005
2-[(3E)-3-benzylidene-2-iminopyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone;hydrochloride (PubChem CID 161257005) has the molecular formula C27H35ClN2O2 and a molecular weight of 455.04 g/mol. Its IUPAC name is 2-[(3E)-3-benzylidene-2-iminopyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone;hydrochloride.
| Compound Name | 2-[(3E)-3-benzylidene-2-iminopyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 161257005 |
| Molecular Formula | C27H35ClN2O2 |
| Molecular Weight | 455.04 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 2-[(3E)-3-benzylidene-2-iminopyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone;hydrochloride |
| SMILES | Cl.[H]/N=C1C(=C\c2ccccc2)\CCN\1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H34N2O2.ClH/c1-26(2,3)21-15-20(16-22(24(21)31)27(4,5)6)23(30)17-29-13-12-19(25(29)28)14-18-10-8-7-9-11-18;/h7-11,14-16,28,31H,12-13,17H2,1-6H3;1H/b19-14+,28-25+; |
| InChIKey | YJBPCTJHVCYXBW-UDCIKTCOSA-N |
| XLogP | 6.36 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.04 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|