C26H35BrN2O2 — CID 87653072
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-imino-4-phenylpyrrolidin-1-yl)ethanone;hydrobromide (PubChem CID 87653072) has the molecular formula C26H35BrN2O2 and a molecular weight of 487.48 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-imino-4-phenylpyrrolidin-1-yl)ethanone;hydrobromide.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-imino-4-phenylpyrrolidin-1-yl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 87653072 |
| Molecular Formula | C26H35BrN2O2 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(2-imino-4-phenylpyrrolidin-1-yl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=C1\CC(c2ccccc2)CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H34N2O2.BrH/c1-25(2,3)20-12-18(13-21(24(20)30)26(4,5)6)22(29)16-28-15-19(14-23(28)27)17-10-8-7-9-11-17;/h7-13,19,27,30H,14-16H2,1-6H3;1H/b27-23+; |
| InChIKey | ZCSPTVNVTURXCH-VZXOMLSWSA-N |
| XLogP | 6.21 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|