C31H45BrN2O2 — CID 87652489
2-(3-benzyl-4,4-diethyl-2-iminopyrrolidin-1-yl)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone;hydrobromide (PubChem CID 87652489) has the molecular formula C31H45BrN2O2 and a molecular weight of 557.62 g/mol. Its IUPAC name is 2-(3-benzyl-4,4-diethyl-2-iminopyrrolidin-1-yl)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone;hydrobromide.
| Compound Name | 2-(3-benzyl-4,4-diethyl-2-iminopyrrolidin-1-yl)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 87652489 |
| Molecular Formula | C31H45BrN2O2 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 2-(3-benzyl-4,4-diethyl-2-iminopyrrolidin-1-yl)-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=C1/C(Cc2ccccc2)C(CC)(CC)CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H44N2O2.BrH/c1-9-31(10-2)20-33(28(32)25(31)16-21-14-12-11-13-15-21)19-26(34)22-17-23(29(3,4)5)27(35)24(18-22)30(6,7)8;/h11-15,17-18,25,32,35H,9-10,16,19-20H2,1-8H3;1H/b32-28-; |
| InChIKey | FTCPGFVCGDIWSV-AYIPHYDFSA-N |
| XLogP | 7.71 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|