C31H41N3O2 — CID 76556797
4-[[1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-2-imino-4-propylpyrrolidin-3-yl]methyl]benzonitrile (PubChem CID 76556797) has the molecular formula C31H41N3O2 and a molecular weight of 487.69 g/mol. Its IUPAC name is 4-[[1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-2-imino-4-propylpyrrolidin-3-yl]methyl]benzonitrile.
| Compound Name | 4-[[1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-2-imino-4-propylpyrrolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 76556797 |
| Molecular Formula | C31H41N3O2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | 4-[[1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-2-imino-4-propylpyrrolidin-3-yl]methyl]benzonitrile |
| SMILES | [H]/N=C1\C(Cc2ccc(C#N)cc2)C(CCC)CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H41N3O2/c1-8-9-22-18-34(29(33)24(22)14-20-10-12-21(17-32)13-11-20)19-27(35)23-15-25(30(2,3)4)28(36)26(16-23)31(5,6)7/h10-13,15-16,22,24,33,36H,8-9,14,18-19H2,1-7H3/b33-29+ |
| InChIKey | XFXUCFBKFNROLK-XPXRSFDGSA-N |
| XLogP | 6.61 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|