C29H43BrN2O — CID 157210972
4-[[(3R,4R)-3-benzyl-2-imino-4-propylpyrrolidin-1-yl]methyl]-2,6-ditert-butylphenol;hydrobromide (PubChem CID 157210972) has the molecular formula C29H43BrN2O and a molecular weight of 515.58 g/mol. Its IUPAC name is 4-[[(3R,4R)-3-benzyl-2-imino-4-propylpyrrolidin-1-yl]methyl]-2,6-ditert-butylphenol;hydrobromide.
| Compound Name | 4-[[(3R,4R)-3-benzyl-2-imino-4-propylpyrrolidin-1-yl]methyl]-2,6-ditert-butylphenol;hydrobromide |
|---|---|
| PubChem CID | 157210972 |
| Molecular Formula | C29H43BrN2O |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 4-[[(3R,4R)-3-benzyl-2-imino-4-propylpyrrolidin-1-yl]methyl]-2,6-ditert-butylphenol;hydrobromide |
| SMILES | Br.[H]/N=C1\[C@H](Cc2ccccc2)[C@@H](CCC)CN1Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H42N2O.BrH/c1-8-12-22-19-31(27(30)23(22)15-20-13-10-9-11-14-20)18-21-16-24(28(2,3)4)26(32)25(17-21)29(5,6)7;/h9-11,13-14,16-17,22-23,30,32H,8,12,15,18-19H2,1-7H3;1H/b30-27+;/t22-,23+;/m0./s1 |
| InChIKey | GYBWVNFTJPJPQG-XAZXIUDDSA-N |
| XLogP | 7.63 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|