C33H48N2O3 — CID 76556821
2-[3-benzyl-2-(2-methoxyethylimino)-4-propylpyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone (PubChem CID 76556821) has the molecular formula C33H48N2O3 and a molecular weight of 520.76 g/mol. Its IUPAC name is 2-[3-benzyl-2-(2-methoxyethylimino)-4-propylpyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone.
| Compound Name | 2-[3-benzyl-2-(2-methoxyethylimino)-4-propylpyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 76556821 |
| Molecular Formula | C33H48N2O3 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | 2-[3-benzyl-2-(2-methoxyethylimino)-4-propylpyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
| SMILES | CCCC1CN(CC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)/C(=N/CCOC)C1Cc1ccccc1 |
| InChI | InChI=1S/C33H48N2O3/c1-9-13-24-21-35(31(34-16-17-38-8)26(24)18-23-14-11-10-12-15-23)22-29(36)25-19-27(32(2,3)4)30(37)28(20-25)33(5,6)7/h10-12,14-15,19-20,24,26,37H,9,13,16-18,21-22H2,1-8H3/b34-31+ |
| InChIKey | KPUMFBBSZQHION-WUVHBKSUSA-N |
| XLogP | 6.81 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|