C30H41BrN2O2 — CID 173486254
2-[(3R,4S)-3-benzyl-2-bromoimino-4-propylpyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone (PubChem CID 173486254) has the molecular formula C30H41BrN2O2 and a molecular weight of 541.57 g/mol. Its IUPAC name is 2-[(3R,4S)-3-benzyl-2-bromoimino-4-propylpyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone.
| Compound Name | 2-[(3R,4S)-3-benzyl-2-bromoimino-4-propylpyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 173486254 |
| Molecular Formula | C30H41BrN2O2 |
| Molecular Weight | 541.57 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2-[(3R,4S)-3-benzyl-2-bromoimino-4-propylpyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
| SMILES | CCC[C@@H]1CN(CC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=NBr)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H41BrN2O2/c1-8-12-21-18-33(28(32-31)23(21)15-20-13-10-9-11-14-20)19-26(34)22-16-24(29(2,3)4)27(35)25(17-22)30(5,6)7/h9-11,13-14,16-17,21,23,35H,8,12,15,18-19H2,1-7H3/t21-,23-/m1/s1 |
| InChIKey | IBAPKJWLSACJMY-FYYLOGMGSA-N |
| XLogP | 7.47 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|