C29H39BrN2O3 — CID 173486284
2-[(3R,4R)-3-benzyl-2-bromoimino-4-(methoxymethyl)pyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone (PubChem CID 173486284) has the molecular formula C29H39BrN2O3 and a molecular weight of 543.55 g/mol. Its IUPAC name is 2-[(3R,4R)-3-benzyl-2-bromoimino-4-(methoxymethyl)pyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone.
| Compound Name | 2-[(3R,4R)-3-benzyl-2-bromoimino-4-(methoxymethyl)pyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 173486284 |
| Molecular Formula | C29H39BrN2O3 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | 2-[(3R,4R)-3-benzyl-2-bromoimino-4-(methoxymethyl)pyrrolidin-1-yl]-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
| SMILES | COC[C@H]1CN(CC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=NBr)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H39BrN2O3/c1-28(2,3)23-14-20(15-24(26(23)34)29(4,5)6)25(33)17-32-16-21(18-35-7)22(27(32)31-30)13-19-11-9-8-10-12-19/h8-12,14-15,21-22,34H,13,16-18H2,1-7H3/t21-,22-/m1/s1 |
| InChIKey | AJOIBUKNXVVFCX-FGZHOGPDSA-N |
| XLogP | 6.32 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|