C32H44ClN3O — CID 87651625
(E)-4-(3-benzyl-2-imino-4-propylpyrrolidin-1-yl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)but-2-enenitrile;hydrochloride (PubChem CID 87651625) has the molecular formula C32H44ClN3O and a molecular weight of 522.18 g/mol. Its IUPAC name is (E)-4-(3-benzyl-2-imino-4-propylpyrrolidin-1-yl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)but-2-enenitrile;hydrochloride.
| Compound Name | (E)-4-(3-benzyl-2-imino-4-propylpyrrolidin-1-yl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)but-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 87651625 |
| Molecular Formula | C32H44ClN3O |
| Molecular Weight | 522.18 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | (E)-4-(3-benzyl-2-imino-4-propylpyrrolidin-1-yl)-3-(3,5-ditert-butyl-4-hydroxyphenyl)but-2-enenitrile;hydrochloride |
| SMILES | Cl.[H]/N=C1\C(Cc2ccccc2)C(CCC)CN1C/C(=C/C#N)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H43N3O.ClH/c1-8-12-24-21-35(30(34)26(24)17-22-13-10-9-11-14-22)20-23(15-16-33)25-18-27(31(2,3)4)29(36)28(19-25)32(5,6)7;/h9-11,13-15,18-19,24,26,34,36H,8,12,17,20-21H2,1-7H3;1H/b23-15-,34-30+; |
| InChIKey | UJAOZOCTCWTYPG-GQGRPZNOSA-N |
| XLogP | 7.88 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.18 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|