C32H47BrN2O4 — CID 159859583
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[(3S,4R)-2-imino-3-[4-(2-methoxyethoxy)phenyl]-4-propylpyrrolidin-1-yl]ethanone;hydrobromide (PubChem CID 159859583) has the molecular formula C32H47BrN2O4 and a molecular weight of 603.64 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[(3S,4R)-2-imino-3-[4-(2-methoxyethoxy)phenyl]-4-propylpyrrolidin-1-yl]ethanone;hydrobromide.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[(3S,4R)-2-imino-3-[4-(2-methoxyethoxy)phenyl]-4-propylpyrrolidin-1-yl]ethanone;hydrobromide |
|---|---|
| PubChem CID | 159859583 |
| Molecular Formula | C32H47BrN2O4 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[(3S,4R)-2-imino-3-[4-(2-methoxyethoxy)phenyl]-4-propylpyrrolidin-1-yl]ethanone;hydrobromide |
| SMILES | Br.[H]/N=C1/[C@H](c2ccc(OCCOC)cc2)[C@@H](CCC)CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H46N2O4.BrH/c1-9-10-22-19-34(30(33)28(22)21-11-13-24(14-12-21)38-16-15-37-8)20-27(35)23-17-25(31(2,3)4)29(36)26(18-23)32(5,6)7;/h11-14,17-18,22,28,33,36H,9-10,15-16,19-20H2,1-8H3;1H/b33-30-;/t22-,28+;/m0./s1 |
| InChIKey | LAZDPDWSRIBWHL-PUBIQANESA-N |
| XLogP | 7.27 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|