C29H39N3O4 — CID 69006454
2-[2-tert-butyl-6-(dimethylamino)-4-[2-(2-imino-3-phenyl-4-propylpyrrolidin-1-yl)acetyl]phenoxy]acetic acid (PubChem CID 69006454) has the molecular formula C29H39N3O4 and a molecular weight of 493.65 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-(dimethylamino)-4-[2-(2-imino-3-phenyl-4-propylpyrrolidin-1-yl)acetyl]phenoxy]acetic acid.
| Compound Name | 2-[2-tert-butyl-6-(dimethylamino)-4-[2-(2-imino-3-phenyl-4-propylpyrrolidin-1-yl)acetyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 69006454 |
| Molecular Formula | C29H39N3O4 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 2-[2-tert-butyl-6-(dimethylamino)-4-[2-(2-imino-3-phenyl-4-propylpyrrolidin-1-yl)acetyl]phenoxy]acetic acid |
| SMILES | [H]/N=C1/C(c2ccccc2)C(CCC)CN1CC(=O)c1cc(N(C)C)c(OCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H39N3O4/c1-7-11-20-16-32(28(30)26(20)19-12-9-8-10-13-19)17-24(33)21-14-22(29(2,3)4)27(36-18-25(34)35)23(15-21)31(5)6/h8-10,12-15,20,26,30H,7,11,16-18H2,1-6H3,(H,34,35)/b30-28- |
| InChIKey | QRVIXDZORCUCEC-HYOGKJQXSA-N |
| XLogP | 5.19 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|