C28H37N3O3 — CID 87652252
(3R)-1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-5-imino-N-methyl-4-phenylpyrrolidine-3-carboxamide (PubChem CID 87652252) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is (3R)-1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-5-imino-N-methyl-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-5-imino-N-methyl-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 87652252 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (3R)-1-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-oxoethyl]-5-imino-N-methyl-4-phenylpyrrolidine-3-carboxamide |
| SMILES | [H]/N=C1/C(c2ccccc2)[C@@H](C(=O)NC)CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H37N3O3/c1-27(2,3)20-13-18(14-21(24(20)33)28(4,5)6)22(32)16-31-15-19(26(34)30-7)23(25(31)29)17-11-9-8-10-12-17/h8-14,19,23,29,33H,15-16H2,1-7H3,(H,30,34)/b29-25-/t19-,23?/m0/s1 |
| InChIKey | OLIISHJSKNLKBX-CHNGXLBUSA-N |
| XLogP | 4.61 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|