C29H47BrN2O3 — CID 87651814
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[5-(2-ethyl-2-hydroxybutyl)-3-imino-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethanone;hydrobromide (PubChem CID 87651814) has the molecular formula C29H47BrN2O3 and a molecular weight of 551.61 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[5-(2-ethyl-2-hydroxybutyl)-3-imino-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethanone;hydrobromide.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[5-(2-ethyl-2-hydroxybutyl)-3-imino-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethanone;hydrobromide |
|---|---|
| PubChem CID | 87651814 |
| Molecular Formula | C29H47BrN2O3 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-[5-(2-ethyl-2-hydroxybutyl)-3-imino-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethanone;hydrobromide |
| SMILES | Br.[H]/N=C1\C2CC(CC(O)(CC)CC)CC2CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H46N2O3.BrH/c1-9-29(34,10-2)15-18-11-20-16-31(26(30)21(20)12-18)17-24(32)19-13-22(27(3,4)5)25(33)23(14-19)28(6,7)8;/h13-14,18,20-21,30,33-34H,9-12,15-17H2,1-8H3;1H/b30-26+; |
| InChIKey | JRKUJUXSZOOGGI-REAKUJNMSA-N |
| XLogP | 6.62 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|