C23H29N3O2 — CID 87284414
1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(5-imino-7H-pyrrolo[3,4-b]pyridin-6-yl)ethanone (PubChem CID 87284414) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(5-imino-7H-pyrrolo[3,4-b]pyridin-6-yl)ethanone.
| Compound Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(5-imino-7H-pyrrolo[3,4-b]pyridin-6-yl)ethanone |
|---|---|
| PubChem CID | 87284414 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(5-imino-7H-pyrrolo[3,4-b]pyridin-6-yl)ethanone |
| SMILES | [H]/N=C1/c2cccnc2CN1CC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H29N3O2/c1-22(2,3)16-10-14(11-17(20(16)28)23(4,5)6)19(27)13-26-12-18-15(21(26)24)8-7-9-25-18/h7-11,24,28H,12-13H2,1-6H3/b24-21- |
| InChIKey | VSMPDYKQTMABMO-FLFQWRMESA-N |
| XLogP | 4.41 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|