C27H27N3O4 — CID 52919590
1-(3-tert-butyl-4-hydroxyphenyl)-2-(15-imino-2,11-dioxa-5,16-diazatetracyclo[10.7.0.04,9.014,18]nonadeca-1(12),4(9),5,7,13,18-hexaen-16-yl)ethanone (PubChem CID 52919590) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-(3-tert-butyl-4-hydroxyphenyl)-2-(15-imino-2,11-dioxa-5,16-diazatetracyclo[10.7.0.04,9.014,18]nonadeca-1(12),4(9),5,7,13,18-hexaen-16-yl)ethanone.
| Compound Name | 1-(3-tert-butyl-4-hydroxyphenyl)-2-(15-imino-2,11-dioxa-5,16-diazatetracyclo[10.7.0.04,9.014,18]nonadeca-1(12),4(9),5,7,13,18-hexaen-16-yl)ethanone |
|---|---|
| PubChem CID | 52919590 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-(3-tert-butyl-4-hydroxyphenyl)-2-(15-imino-2,11-dioxa-5,16-diazatetracyclo[10.7.0.04,9.014,18]nonadeca-1(12),4(9),5,7,13,18-hexaen-16-yl)ethanone |
| SMILES | [H]/N=C1/c2cc3c(cc2CN1CC(=O)c1ccc(O)c(C(C)(C)C)c1)OCc1ncccc1CO3 |
| InChI | InChI=1S/C27H27N3O4/c1-27(2,3)20-9-16(6-7-22(20)31)23(32)13-30-12-18-10-24-25(11-19(18)26(30)28)33-14-17-5-4-8-29-21(17)15-34-24/h4-11,28,31H,12-15H2,1-3H3/b28-26- |
| InChIKey | LRWZWSNKQPBPCX-SGEDCAFJSA-N |
| XLogP | 4.58 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|