C26H33N3O5 — CID 58910000
2-[2-(3-tert-butyl-5-ethoxy-4-hydroxyphenyl)-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide (PubChem CID 58910000) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[2-(3-tert-butyl-5-ethoxy-4-hydroxyphenyl)-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide.
| Compound Name | 2-[2-(3-tert-butyl-5-ethoxy-4-hydroxyphenyl)-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 58910000 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 2-[2-(3-tert-butyl-5-ethoxy-4-hydroxyphenyl)-2-oxoethyl]-6-ethoxy-3-imino-N-methyl-1H-isoindole-5-carboxamide |
| SMILES | [H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(OCC)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H33N3O5/c1-7-33-21-11-16-13-29(24(27)17(16)12-18(21)25(32)28-6)14-20(30)15-9-19(26(3,4)5)23(31)22(10-15)34-8-2/h9-12,27,31H,7-8,13-14H2,1-6H3,(H,28,32)/b27-24- |
| InChIKey | ZMGCDUJETFYEPF-PNHLSOANSA-N |
| XLogP | 3.87 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|