C24H29N3O5 — CID 87283894
2-[2-(3-tert-butyl-4-hydroxy-5-methoxyphenyl)-2-oxoethyl]-6-ethoxy-3-imino-1H-isoindole-5-carboxamide (PubChem CID 87283894) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[2-(3-tert-butyl-4-hydroxy-5-methoxyphenyl)-2-oxoethyl]-6-ethoxy-3-imino-1H-isoindole-5-carboxamide.
| Compound Name | 2-[2-(3-tert-butyl-4-hydroxy-5-methoxyphenyl)-2-oxoethyl]-6-ethoxy-3-imino-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 87283894 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-[2-(3-tert-butyl-4-hydroxy-5-methoxyphenyl)-2-oxoethyl]-6-ethoxy-3-imino-1H-isoindole-5-carboxamide |
| SMILES | [H]/N=C1/c2cc(C(N)=O)c(OCC)cc2CN1CC(=O)c1cc(OC)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H29N3O5/c1-6-32-19-9-14-11-27(22(25)15(14)10-16(19)23(26)30)12-18(28)13-7-17(24(2,3)4)21(29)20(8-13)31-5/h7-10,25,29H,6,11-12H2,1-5H3,(H2,26,30)/b25-22- |
| InChIKey | BISTZPWPLDYCRE-LVWGJNHUSA-N |
| XLogP | 3.22 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|