C26H33N3O5 — CID 87284657
4-[3-tert-butyl-5-[2-(5-ethoxy-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide (PubChem CID 87284657) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[3-tert-butyl-5-[2-(5-ethoxy-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide.
| Compound Name | 4-[3-tert-butyl-5-[2-(5-ethoxy-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide |
|---|---|
| PubChem CID | 87284657 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4-[3-tert-butyl-5-[2-(5-ethoxy-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide |
| SMILES | [H]/N=C1/c2cc(OCC)ccc2CN1CC(=O)c1cc(OCCCC(N)=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H33N3O5/c1-5-33-18-9-8-16-14-29(25(28)19(16)13-18)15-21(30)17-11-20(26(2,3)4)24(32)22(12-17)34-10-6-7-23(27)31/h8-9,11-13,28,32H,5-7,10,14-15H2,1-4H3,(H2,27,31)/b28-25- |
| InChIKey | AWFJSKCNDQWBFA-FVDSYPCUSA-N |
| XLogP | 3.76 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|