C26H33BrFN3O5 — CID 87842491
4-[3-tert-butyl-5-[2-(6-ethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide;hydrobromide (PubChem CID 87842491) has the molecular formula C26H33BrFN3O5 and a molecular weight of 566.47 g/mol. Its IUPAC name is 4-[3-tert-butyl-5-[2-(6-ethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide;hydrobromide.
| Compound Name | 4-[3-tert-butyl-5-[2-(6-ethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide;hydrobromide |
|---|---|
| PubChem CID | 87842491 |
| Molecular Formula | C26H33BrFN3O5 |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 4-[3-tert-butyl-5-[2-(6-ethoxy-4-fluoro-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide;hydrobromide |
| SMILES | Br.[H]/N=C1/c2c(F)cc(OCC)cc2CN1CC(=O)c1cc(OCCCC(N)=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H32FN3O5.BrH/c1-5-34-17-9-16-13-30(25(29)23(16)19(27)12-17)14-20(31)15-10-18(26(2,3)4)24(33)21(11-15)35-8-6-7-22(28)32;/h9-12,29,33H,5-8,13-14H2,1-4H3,(H2,28,32);1H/b29-25-; |
| InChIKey | DXGYGQLPIQUUGG-PKPTZPFZSA-N |
| XLogP | 4.47 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|