C28H37N3O4 — CID 87284098
4-[3-tert-butyl-5-[2-(5-tert-butyl-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide (PubChem CID 87284098) has the molecular formula C28H37N3O4 and a molecular weight of 479.62 g/mol. Its IUPAC name is 4-[3-tert-butyl-5-[2-(5-tert-butyl-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide.
| Compound Name | 4-[3-tert-butyl-5-[2-(5-tert-butyl-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide |
|---|---|
| PubChem CID | 87284098 |
| Molecular Formula | C28H37N3O4 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | 4-[3-tert-butyl-5-[2-(5-tert-butyl-3-imino-1H-isoindol-2-yl)acetyl]-2-hydroxyphenoxy]butanamide |
| SMILES | [H]/N=C1/c2cc(C(C)(C)C)ccc2CN1CC(=O)c1cc(OCCCC(N)=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H37N3O4/c1-27(2,3)19-10-9-17-15-31(26(30)20(17)14-19)16-22(32)18-12-21(28(4,5)6)25(34)23(13-18)35-11-7-8-24(29)33/h9-10,12-14,30,34H,7-8,11,15-16H2,1-6H3,(H2,29,33)/b30-26- |
| InChIKey | BOTXSERHCUTMCF-BXVZCJGGSA-N |
| XLogP | 4.66 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|