C29H39BrN4O6 — CID 87283995
4-[3-tert-butyl-5-[2-[6-ethoxy-3-imino-5-[2-(methylamino)-2-oxoethyl]-1H-isoindol-2-yl]acetyl]-2-hydroxyphenoxy]butanamide;hydrobromide (PubChem CID 87283995) has the molecular formula C29H39BrN4O6 and a molecular weight of 619.56 g/mol. Its IUPAC name is 4-[3-tert-butyl-5-[2-[6-ethoxy-3-imino-5-[2-(methylamino)-2-oxoethyl]-1H-isoindol-2-yl]acetyl]-2-hydroxyphenoxy]butanamide;hydrobromide.
| Compound Name | 4-[3-tert-butyl-5-[2-[6-ethoxy-3-imino-5-[2-(methylamino)-2-oxoethyl]-1H-isoindol-2-yl]acetyl]-2-hydroxyphenoxy]butanamide;hydrobromide |
|---|---|
| PubChem CID | 87283995 |
| Molecular Formula | C29H39BrN4O6 |
| Molecular Weight | 619.56 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 4-[3-tert-butyl-5-[2-[6-ethoxy-3-imino-5-[2-(methylamino)-2-oxoethyl]-1H-isoindol-2-yl]acetyl]-2-hydroxyphenoxy]butanamide;hydrobromide |
| SMILES | Br.[H]/N=C1/c2cc(CC(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(OCCCC(N)=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H38N4O6.BrH/c1-6-38-23-13-19-15-33(28(31)20(19)10-18(23)14-26(36)32-5)16-22(34)17-11-21(29(2,3)4)27(37)24(12-17)39-9-7-8-25(30)35;/h10-13,31,37H,6-9,14-16H2,1-5H3,(H2,30,35)(H,32,36);1H/b31-28-; |
| InChIKey | BTEFUIKORYOOOW-GIBMLHLSSA-N |
| XLogP | 3.62 |
| TPSA | 155.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|