C28H37BrN4O6 — CID 67138377
2-[2-[3-(4-amino-4-oxobutoxy)-5-tert-butyl-4-methoxyphenyl]-2-oxoethyl]-6-ethoxy-3-imino-1H-isoindole-5-carboxamide;hydrobromide (PubChem CID 67138377) has the molecular formula C28H37BrN4O6 and a molecular weight of 605.53 g/mol. Its IUPAC name is 2-[2-[3-(4-amino-4-oxobutoxy)-5-tert-butyl-4-methoxyphenyl]-2-oxoethyl]-6-ethoxy-3-imino-1H-isoindole-5-carboxamide;hydrobromide.
| Compound Name | 2-[2-[3-(4-amino-4-oxobutoxy)-5-tert-butyl-4-methoxyphenyl]-2-oxoethyl]-6-ethoxy-3-imino-1H-isoindole-5-carboxamide;hydrobromide |
|---|---|
| PubChem CID | 67138377 |
| Molecular Formula | C28H37BrN4O6 |
| Molecular Weight | 605.53 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 2-[2-[3-(4-amino-4-oxobutoxy)-5-tert-butyl-4-methoxyphenyl]-2-oxoethyl]-6-ethoxy-3-imino-1H-isoindole-5-carboxamide;hydrobromide |
| SMILES | Br.[H]/N=C1/c2cc(C(N)=O)c(OCC)cc2CN1CC(=O)c1cc(OCCCC(N)=O)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H36N4O6.BrH/c1-6-37-22-12-17-14-32(26(30)18(17)13-19(22)27(31)35)15-21(33)16-10-20(28(2,3)4)25(36-5)23(11-16)38-9-7-8-24(29)34;/h10-13,30H,6-9,14-15H2,1-5H3,(H2,29,34)(H2,31,35);1H/b30-26-; |
| InChIKey | AHTWWEKILFBZET-AFCPYBGBSA-N |
| XLogP | 3.74 |
| TPSA | 158.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|