C31H42N4O6 — CID 67137415
6-[2-tert-butyl-4-[2-(5-carbamoyl-6-ethoxy-3-imino-1H-isoindol-2-yl)acetyl]-6-(dimethylamino)phenoxy]hexanoic acid (PubChem CID 67137415) has the molecular formula C31H42N4O6 and a molecular weight of 566.70 g/mol. Its IUPAC name is 6-[2-tert-butyl-4-[2-(5-carbamoyl-6-ethoxy-3-imino-1H-isoindol-2-yl)acetyl]-6-(dimethylamino)phenoxy]hexanoic acid.
| Compound Name | 6-[2-tert-butyl-4-[2-(5-carbamoyl-6-ethoxy-3-imino-1H-isoindol-2-yl)acetyl]-6-(dimethylamino)phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 67137415 |
| Molecular Formula | C31H42N4O6 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 6-[2-tert-butyl-4-[2-(5-carbamoyl-6-ethoxy-3-imino-1H-isoindol-2-yl)acetyl]-6-(dimethylamino)phenoxy]hexanoic acid |
| SMILES | [H]/N=C1/c2cc(C(N)=O)c(OCC)cc2CN1CC(=O)c1cc(N(C)C)c(OCCCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H42N4O6/c1-7-40-26-15-20-17-35(29(32)21(20)16-22(26)30(33)39)18-25(36)19-13-23(31(2,3)4)28(24(14-19)34(5)6)41-12-10-8-9-11-27(37)38/h13-16,32H,7-12,17-18H2,1-6H3,(H2,33,39)(H,37,38)/b32-29- |
| InChIKey | SJTOMTGYMOGMEF-OVXWJCGASA-N |
| XLogP | 4.60 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|