C34H45N3O7 — CID 67137397
5-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-pent-4-enoxyphenoxy]pentanoic acid (PubChem CID 67137397) has the molecular formula C34H45N3O7 and a molecular weight of 607.75 g/mol. Its IUPAC name is 5-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-pent-4-enoxyphenoxy]pentanoic acid.
| Compound Name | 5-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-pent-4-enoxyphenoxy]pentanoic acid |
|---|---|
| PubChem CID | 67137397 |
| Molecular Formula | C34H45N3O7 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.33 |
| IUPAC Name | 5-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-pent-4-enoxyphenoxy]pentanoic acid |
| SMILES | [H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(OCCCC=C)c(OCCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H45N3O7/c1-7-9-11-14-43-29-17-22(16-26(34(3,4)5)31(29)44-15-12-10-13-30(39)40)27(38)21-37-20-23-18-28(42-8-2)25(33(41)36-6)19-24(23)32(37)35/h7,16-19,35H,1,8-15,20-21H2,2-6H3,(H,36,41)(H,39,40)/b35-32- |
| InChIKey | PKNMCMJGTWHLOW-JCUPVDEDSA-N |
| XLogP | 5.74 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|