C31H43BrN4O6 — CID 69459895
4-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-[ethyl(methyl)amino]phenoxy]butanoic acid;hydrobromide (PubChem CID 69459895) has the molecular formula C31H43BrN4O6 and a molecular weight of 647.61 g/mol. Its IUPAC name is 4-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-[ethyl(methyl)amino]phenoxy]butanoic acid;hydrobromide.
| Compound Name | 4-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-[ethyl(methyl)amino]phenoxy]butanoic acid;hydrobromide |
|---|---|
| PubChem CID | 69459895 |
| Molecular Formula | C31H43BrN4O6 |
| Molecular Weight | 647.61 g/mol |
| Exact Mass | 646.24 |
| IUPAC Name | 4-[2-tert-butyl-4-[2-[6-ethoxy-3-imino-5-(methylcarbamoyl)-1H-isoindol-2-yl]acetyl]-6-[ethyl(methyl)amino]phenoxy]butanoic acid;hydrobromide |
| SMILES | Br.[H]/N=C1/c2cc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(N(C)CC)c(OCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H42N4O6.BrH/c1-8-34(7)24-14-19(13-23(31(3,4)5)28(24)41-12-10-11-27(37)38)25(36)18-35-17-20-15-26(40-9-2)22(30(39)33-6)16-21(20)29(35)32;/h13-16,32H,8-12,17-18H2,1-7H3,(H,33,39)(H,37,38);1H/b32-29-; |
| InChIKey | QNDCJOSCKWKIJR-ILHCEFDCSA-N |
| XLogP | 5.04 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.61 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|