C25H31N3O5 — CID 87284639
4-[3-tert-butyl-2-hydroxy-5-[2-(3-imino-6-methoxy-1H-isoindol-2-yl)acetyl]phenoxy]butanamide (PubChem CID 87284639) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-[3-tert-butyl-2-hydroxy-5-[2-(3-imino-6-methoxy-1H-isoindol-2-yl)acetyl]phenoxy]butanamide.
| Compound Name | 4-[3-tert-butyl-2-hydroxy-5-[2-(3-imino-6-methoxy-1H-isoindol-2-yl)acetyl]phenoxy]butanamide |
|---|---|
| PubChem CID | 87284639 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[3-tert-butyl-2-hydroxy-5-[2-(3-imino-6-methoxy-1H-isoindol-2-yl)acetyl]phenoxy]butanamide |
| SMILES | [H]/N=C1/c2ccc(OC)cc2CN1CC(=O)c1cc(OCCCC(N)=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H31N3O5/c1-25(2,3)19-11-15(12-21(23(19)31)33-9-5-6-22(26)30)20(29)14-28-13-16-10-17(32-4)7-8-18(16)24(28)27/h7-8,10-12,27,31H,5-6,9,13-14H2,1-4H3,(H2,26,30)/b27-24- |
| InChIKey | UCYCVCBRNFYOGR-PNHLSOANSA-N |
| XLogP | 3.37 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|